C16H16Cl2N2O4S — CID 92671353
(E)-N-(2,5-dichlorophenyl)-3-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]prop-2-enamide (PubChem CID 92671353) has the molecular formula C16H16Cl2N2O4S and a molecular weight of 403.29 g/mol. Its IUPAC name is (E)-N-(2,5-dichlorophenyl)-3-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(2,5-dichlorophenyl)-3-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 92671353 |
| Molecular Formula | C16H16Cl2N2O4S |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | (E)-N-(2,5-dichlorophenyl)-3-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]prop-2-enamide |
| SMILES | CN(Cc1ccc(/C=C/C(=O)Nc2cc(Cl)ccc2Cl)o1)S(C)(=O)=O |
| InChI | InChI=1S/C16H16Cl2N2O4S/c1-20(25(2,22)23)10-13-5-4-12(24-13)6-8-16(21)19-15-9-11(17)3-7-14(15)18/h3-9H,10H2,1-2H3,(H,19,21)/b8-6+ |
| InChIKey | ACAYBOGDKRKRLK-SOFGYWHQSA-N |
| XLogP | 3.63 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|