C18H21ClN2O6S — CID 92671416
(E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]prop-2-enamide (PubChem CID 92671416) has the molecular formula C18H21ClN2O6S and a molecular weight of 428.89 g/mol. Its IUPAC name is (E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 92671416 |
| Molecular Formula | C18H21ClN2O6S |
| Molecular Weight | 428.89 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | (E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]prop-2-enamide |
| SMILES | COc1cc(NC(=O)/C=C/c2ccc(CN(C)S(C)(=O)=O)o2)c(OC)cc1Cl |
| InChI | InChI=1S/C18H21ClN2O6S/c1-21(28(4,23)24)11-13-6-5-12(27-13)7-8-18(22)20-15-10-16(25-2)14(19)9-17(15)26-3/h5-10H,11H2,1-4H3,(H,20,22)/b8-7+ |
| InChIKey | JOBUZJSJKQRXAN-BQYQJAHWSA-N |
| XLogP | 2.99 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.89 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|