C18H19ClN2O5S — CID 30296515
(E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide (PubChem CID 30296515) has the molecular formula C18H19ClN2O5S and a molecular weight of 410.88 g/mol. Its IUPAC name is (E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 30296515 |
| Molecular Formula | C18H19ClN2O5S |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | (E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
| SMILES | COc1cc(NC(=O)/C=C/c2ccc(NS(C)(=O)=O)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C18H19ClN2O5S/c1-25-16-11-15(17(26-2)10-14(16)19)20-18(22)9-6-12-4-7-13(8-5-12)21-27(3,23)24/h4-11,21H,1-3H3,(H,20,22)/b9-6+ |
| InChIKey | BTXFFSSSEPSGDV-RMKNXTFCSA-N |
| XLogP | 3.38 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|