C15H13ClN2O6 — CID 9092235
(E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-(5-nitrofuran-2-yl)prop-2-enamide (PubChem CID 9092235) has the molecular formula C15H13ClN2O6 and a molecular weight of 352.73 g/mol. Its IUPAC name is (E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-(5-nitrofuran-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-(5-nitrofuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9092235 |
| Molecular Formula | C15H13ClN2O6 |
| Molecular Weight | 352.73 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | (E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-(5-nitrofuran-2-yl)prop-2-enamide |
| SMILES | COc1cc(NC(=O)/C=C/c2ccc([N+](=O)[O-])o2)c(OC)cc1Cl |
| InChI | InChI=1S/C15H13ClN2O6/c1-22-12-8-11(13(23-2)7-10(12)16)17-14(19)5-3-9-4-6-15(24-9)18(20)21/h3-8H,1-2H3,(H,17,19)/b5-3+ |
| InChIKey | JFMUDTOHEHFWPW-HWKANZROSA-N |
| XLogP | 3.51 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.73 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|