C21H19ClN2O5S — CID 126198474
(E)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-N-(5-chloro-2-methoxyphenyl)prop-2-enamide (PubChem CID 126198474) has the molecular formula C21H19ClN2O5S and a molecular weight of 446.91 g/mol. Its IUPAC name is (E)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-N-(5-chloro-2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-N-(5-chloro-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126198474 |
| Molecular Formula | C21H19ClN2O5S |
| Molecular Weight | 446.91 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | (E)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-N-(5-chloro-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)/C=C/c1ccc(CNS(=O)(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C21H19ClN2O5S/c1-28-20-11-7-15(22)13-19(20)24-21(25)12-10-16-8-9-17(29-16)14-23-30(26,27)18-5-3-2-4-6-18/h2-13,23H,14H2,1H3,(H,24,25)/b12-10+ |
| InChIKey | BTVJSYHBRFHVSH-ZRDIBKRKSA-N |
| XLogP | 4.07 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.91 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|