C27H24N2O5S — CID 126197089
(E)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-N-(4-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 126197089) has the molecular formula C27H24N2O5S and a molecular weight of 488.57 g/mol. Its IUPAC name is (E)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-N-(4-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-N-(4-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126197089 |
| Molecular Formula | C27H24N2O5S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | (E)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-N-(4-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(CNS(=O)(=O)c2ccccc2)o1)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H24N2O5S/c30-27(29-22-11-13-23(14-12-22)33-20-21-7-3-1-4-8-21)18-17-24-15-16-25(34-24)19-28-35(31,32)26-9-5-2-6-10-26/h1-18,28H,19-20H2,(H,29,30)/b18-17+ |
| InChIKey | XBPGQNYICXQJSR-ISLYRVAYSA-N |
| XLogP | 4.99 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|