C22H20N2O6S — CID 126198676
(E)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide (PubChem CID 126198676) has the molecular formula C22H20N2O6S and a molecular weight of 440.48 g/mol. Its IUPAC name is (E)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide.
| Compound Name | (E)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 126198676 |
| Molecular Formula | C22H20N2O6S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (E)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(CNS(=O)(=O)c2ccccc2)o1)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H20N2O6S/c25-22(24-16-6-10-20-21(14-16)29-13-12-28-20)11-9-17-7-8-18(30-17)15-23-31(26,27)19-4-2-1-3-5-19/h1-11,14,23H,12-13,15H2,(H,24,25)/b11-9+ |
| InChIKey | XMUZADWXSWLZHJ-PKNBQFBNSA-N |
| XLogP | 3.18 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|