C20H16F2N2O4S — CID 126198755
(E)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-N-(2,6-difluorophenyl)prop-2-enamide (PubChem CID 126198755) has the molecular formula C20H16F2N2O4S and a molecular weight of 418.42 g/mol. Its IUPAC name is (E)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-N-(2,6-difluorophenyl)prop-2-enamide.
| Compound Name | (E)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-N-(2,6-difluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126198755 |
| Molecular Formula | C20H16F2N2O4S |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | (E)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-N-(2,6-difluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(CNS(=O)(=O)c2ccccc2)o1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C20H16F2N2O4S/c21-17-7-4-8-18(22)20(17)24-19(25)12-11-14-9-10-15(28-14)13-23-29(26,27)16-5-2-1-3-6-16/h1-12,23H,13H2,(H,24,25)/b12-11+ |
| InChIKey | DSNLVGMMEKVMEU-VAWYXSNFSA-N |
| XLogP | 3.69 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|