C25H21FN2O6S — CID 1002103
methyl 4-[[5-(benzenesulfonamidomethyl)furan-2-yl]methylidene]-1-(2-fluorophenyl)-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 1002103) has the molecular formula C25H21FN2O6S and a molecular weight of 496.52 g/mol. Its IUPAC name is methyl 4-[[5-(benzenesulfonamidomethyl)furan-2-yl]methylidene]-1-(2-fluorophenyl)-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl 4-[[5-(benzenesulfonamidomethyl)furan-2-yl]methylidene]-1-(2-fluorophenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 1002103 |
| Molecular Formula | C25H21FN2O6S |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | methyl 4-[[5-(benzenesulfonamidomethyl)furan-2-yl]methylidene]-1-(2-fluorophenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccccc2F)C(=O)C1=Cc1ccc(CNS(=O)(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C25H21FN2O6S/c1-16-23(25(30)33-2)20(24(29)28(16)22-11-7-6-10-21(22)26)14-17-12-13-18(34-17)15-27-35(31,32)19-8-4-3-5-9-19/h3-14,27H,15H2,1-2H3 |
| InChIKey | ZSPFUESJOJMJKE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|