C23H22FNO3 — CID 126005877
methyl (4Z)-1-(2-fluorophenyl)-2-methyl-5-oxo-4-[(4-propan-2-ylphenyl)methylidene]pyrrole-3-carboxylate (PubChem CID 126005877) has the molecular formula C23H22FNO3 and a molecular weight of 379.43 g/mol. Its IUPAC name is methyl (4Z)-1-(2-fluorophenyl)-2-methyl-5-oxo-4-[(4-propan-2-ylphenyl)methylidene]pyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-1-(2-fluorophenyl)-2-methyl-5-oxo-4-[(4-propan-2-ylphenyl)methylidene]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126005877 |
| Molecular Formula | C23H22FNO3 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | methyl (4Z)-1-(2-fluorophenyl)-2-methyl-5-oxo-4-[(4-propan-2-ylphenyl)methylidene]pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccccc2F)C(=O)/C1=C\c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C23H22FNO3/c1-14(2)17-11-9-16(10-12-17)13-18-21(23(27)28-4)15(3)25(22(18)26)20-8-6-5-7-19(20)24/h5-14H,1-4H3/b18-13- |
| InChIKey | UJJAQGUVEMWGMV-AQTBWJFISA-N |
| XLogP | 4.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|