C24H22F3NO3 — CID 94833367
methyl (4Z)-2-methyl-5-oxo-1-(4-propan-2-ylphenyl)-4-[[2-(trifluoromethyl)phenyl]methylidene]pyrrole-3-carboxylate (PubChem CID 94833367) has the molecular formula C24H22F3NO3 and a molecular weight of 429.44 g/mol. Its IUPAC name is methyl (4Z)-2-methyl-5-oxo-1-(4-propan-2-ylphenyl)-4-[[2-(trifluoromethyl)phenyl]methylidene]pyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-2-methyl-5-oxo-1-(4-propan-2-ylphenyl)-4-[[2-(trifluoromethyl)phenyl]methylidene]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 94833367 |
| Molecular Formula | C24H22F3NO3 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | methyl (4Z)-2-methyl-5-oxo-1-(4-propan-2-ylphenyl)-4-[[2-(trifluoromethyl)phenyl]methylidene]pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccc(C(C)C)cc2)C(=O)/C1=C\c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H22F3NO3/c1-14(2)16-9-11-18(12-10-16)28-15(3)21(23(30)31-4)19(22(28)29)13-17-7-5-6-8-20(17)24(25,26)27/h5-14H,1-4H3/b19-13- |
| InChIKey | IGQVHVVNBJRRSJ-UYRXBGFRSA-N |
| XLogP | 5.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|