C21H16FNO5 — CID 99863840
methyl (4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(2-fluorophenyl)-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 99863840) has the molecular formula C21H16FNO5 and a molecular weight of 381.36 g/mol. Its IUPAC name is methyl (4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(2-fluorophenyl)-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(2-fluorophenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 99863840 |
| Molecular Formula | C21H16FNO5 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | methyl (4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(2-fluorophenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccccc2F)C(=O)/C1=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H16FNO5/c1-12-19(21(25)26-2)14(9-13-7-8-17-18(10-13)28-11-27-17)20(24)23(12)16-6-4-3-5-15(16)22/h3-10H,11H2,1-2H3/b14-9+ |
| InChIKey | GCYORLBDQKYYRL-NTEUORMPSA-N |
| XLogP | 3.43 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|