C25H21ClN2O6S — CID 126027565
methyl (4E)-4-[[5-[[(4-chlorophenyl)sulfonylamino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxo-1-phenylpyrrole-3-carboxylate (PubChem CID 126027565) has the molecular formula C25H21ClN2O6S and a molecular weight of 512.97 g/mol. Its IUPAC name is methyl (4E)-4-[[5-[[(4-chlorophenyl)sulfonylamino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxo-1-phenylpyrrole-3-carboxylate.
| Compound Name | methyl (4E)-4-[[5-[[(4-chlorophenyl)sulfonylamino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxo-1-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126027565 |
| Molecular Formula | C25H21ClN2O6S |
| Molecular Weight | 512.97 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | methyl (4E)-4-[[5-[[(4-chlorophenyl)sulfonylamino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxo-1-phenylpyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccccc2)C(=O)/C1=C/c1ccc(CNS(=O)(=O)c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C25H21ClN2O6S/c1-16-23(25(30)33-2)22(24(29)28(16)18-6-4-3-5-7-18)14-19-10-11-20(34-19)15-27-35(31,32)21-12-8-17(26)9-13-21/h3-14,27H,15H2,1-2H3/b22-14+ |
| InChIKey | WNTIBJBOLYSKIV-HYARGMPZSA-N |
| XLogP | 4.29 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.97 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|