C29H29ClN2O7S — CID 126021942
methyl (4E)-4-[[5-[[benzyl-(4-chlorophenyl)sulfonylamino]methyl]furan-2-yl]methylidene]-1-(2-methoxyethyl)-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 126021942) has the molecular formula C29H29ClN2O7S and a molecular weight of 585.08 g/mol. Its IUPAC name is methyl (4E)-4-[[5-[[benzyl-(4-chlorophenyl)sulfonylamino]methyl]furan-2-yl]methylidene]-1-(2-methoxyethyl)-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4E)-4-[[5-[[benzyl-(4-chlorophenyl)sulfonylamino]methyl]furan-2-yl]methylidene]-1-(2-methoxyethyl)-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126021942 |
| Molecular Formula | C29H29ClN2O7S |
| Molecular Weight | 585.08 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | methyl (4E)-4-[[5-[[benzyl-(4-chlorophenyl)sulfonylamino]methyl]furan-2-yl]methylidene]-1-(2-methoxyethyl)-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | COCCN1C(=O)/C(=C/c2ccc(CN(Cc3ccccc3)S(=O)(=O)c3ccc(Cl)cc3)o2)C(C(=O)OC)=C1C |
| InChI | InChI=1S/C29H29ClN2O7S/c1-20-27(29(34)38-3)26(28(33)32(20)15-16-37-2)17-23-11-12-24(39-23)19-31(18-21-7-5-4-6-8-21)40(35,36)25-13-9-22(30)10-14-25/h4-14,17H,15-16,18-19H2,1-3H3/b26-17+ |
| InChIKey | RPXXEKXNVZKKTJ-YZSQISJMSA-N |
| XLogP | 4.64 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.08 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|