C34H31BrN2O6S — CID 126017501
ethyl (4E)-4-[[5-[[benzyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylidene]-1-(4-bromophenyl)-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 126017501) has the molecular formula C34H31BrN2O6S and a molecular weight of 675.60 g/mol. Its IUPAC name is ethyl (4E)-4-[[5-[[benzyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylidene]-1-(4-bromophenyl)-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | ethyl (4E)-4-[[5-[[benzyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylidene]-1-(4-bromophenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126017501 |
| Molecular Formula | C34H31BrN2O6S |
| Molecular Weight | 675.60 g/mol |
| Exact Mass | 674.11 |
| IUPAC Name | ethyl (4E)-4-[[5-[[benzyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylidene]-1-(4-bromophenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2ccc(Br)cc2)C(=O)/C1=C/c1ccc(CN(Cc2ccccc2)S(=O)(=O)c2ccc(C)cc2)o1 |
| InChI | InChI=1S/C34H31BrN2O6S/c1-4-42-34(39)32-24(3)37(27-14-12-26(35)13-15-27)33(38)31(32)20-28-16-17-29(43-28)22-36(21-25-8-6-5-7-9-25)44(40,41)30-18-10-23(2)11-19-30/h5-20H,4,21-22H2,1-3H3/b31-20+ |
| InChIKey | GFVVDMKICQLIDO-AJBULDERSA-N |
| XLogP | 7.01 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.60 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|