C31H30N4O7S — CID 98075359
ethyl 4-[[2-[(2E)-2-[[5-[[benzyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate (PubChem CID 98075359) has the molecular formula C31H30N4O7S and a molecular weight of 602.67 g/mol. Its IUPAC name is ethyl 4-[[2-[(2E)-2-[[5-[[benzyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(2E)-2-[[5-[[benzyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 98075359 |
| Molecular Formula | C31H30N4O7S |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | ethyl 4-[[2-[(2E)-2-[[5-[[benzyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(=O)N/N=C/c2ccc(CN(Cc3ccccc3)S(=O)(=O)c3ccc(C)cc3)o2)cc1 |
| InChI | InChI=1S/C31H30N4O7S/c1-3-41-31(38)24-11-13-25(14-12-24)33-29(36)30(37)34-32-19-26-15-16-27(42-26)21-35(20-23-7-5-4-6-8-23)43(39,40)28-17-9-22(2)10-18-28/h4-19H,3,20-21H2,1-2H3,(H,33,36)(H,34,37)/b32-19+ |
| InChIKey | VGPKNYWMPKJROE-BIZUNTBRSA-N |
| XLogP | 4.24 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|