C25H26N4O5S — CID 94839793
N'-[(E)-[5-[[benzyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-prop-2-enyloxamide (PubChem CID 94839793) has the molecular formula C25H26N4O5S and a molecular weight of 494.57 g/mol. Its IUPAC name is N'-[(E)-[5-[[benzyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-prop-2-enyloxamide.
| Compound Name | N'-[(E)-[5-[[benzyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-prop-2-enyloxamide |
|---|---|
| PubChem CID | 94839793 |
| Molecular Formula | C25H26N4O5S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | N'-[(E)-[5-[[benzyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)N/N=C/c1ccc(CN(Cc2ccccc2)S(=O)(=O)c2ccc(C)cc2)o1 |
| InChI | InChI=1S/C25H26N4O5S/c1-3-15-26-24(30)25(31)28-27-16-21-11-12-22(34-21)18-29(17-20-7-5-4-6-8-20)35(32,33)23-13-9-19(2)10-14-23/h3-14,16H,1,15,17-18H2,2H3,(H,26,30)(H,28,31)/b27-16+ |
| InChIKey | CJPUWTXKOCNIHD-JVWAILMASA-N |
| XLogP | 2.73 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|