C28H26ClN5O5S — CID 98062145
N'-[(E)-[5-[[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-(pyridin-2-ylmethyl)oxamide (PubChem CID 98062145) has the molecular formula C28H26ClN5O5S and a molecular weight of 580.07 g/mol. Its IUPAC name is N'-[(E)-[5-[[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-(pyridin-2-ylmethyl)oxamide.
| Compound Name | N'-[(E)-[5-[[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-(pyridin-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 98062145 |
| Molecular Formula | C28H26ClN5O5S |
| Molecular Weight | 580.07 g/mol |
| Exact Mass | 579.13 |
| IUPAC Name | N'-[(E)-[5-[[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-(pyridin-2-ylmethyl)oxamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccc(Cl)cc2)Cc2ccc(/C=N/NC(=O)C(=O)NCc3ccccn3)o2)cc1 |
| InChI | InChI=1S/C28H26ClN5O5S/c1-20-5-13-26(14-6-20)40(37,38)34(18-21-7-9-22(29)10-8-21)19-25-12-11-24(39-25)17-32-33-28(36)27(35)31-16-23-4-2-3-15-30-23/h2-15,17H,16,18-19H2,1H3,(H,31,35)(H,33,36)/b32-17+ |
| InChIKey | VUNCNZMTUNHBAV-VTNSRFBWSA-N |
| XLogP | 3.79 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.07 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|