C31H32N4O6S — CID 98155489
N-(2-ethoxyphenyl)-N'-[(E)-[5-[[(4-methylphenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]oxamide (PubChem CID 98155489) has the molecular formula C31H32N4O6S and a molecular weight of 588.69 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-N'-[(E)-[5-[[(4-methylphenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]oxamide.
| Compound Name | N-(2-ethoxyphenyl)-N'-[(E)-[5-[[(4-methylphenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 98155489 |
| Molecular Formula | C31H32N4O6S |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | N-(2-ethoxyphenyl)-N'-[(E)-[5-[[(4-methylphenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]oxamide |
| SMILES | CCOc1ccccc1NC(=O)C(=O)N/N=C/c1ccc(CN(Cc2ccc(C)cc2)S(=O)(=O)c2ccc(C)cc2)o1 |
| InChI | InChI=1S/C31H32N4O6S/c1-4-40-29-8-6-5-7-28(29)33-30(36)31(37)34-32-19-25-15-16-26(41-25)21-35(20-24-13-9-22(2)10-14-24)42(38,39)27-17-11-23(3)12-18-27/h5-19H,4,20-21H2,1-3H3,(H,33,36)(H,34,37)/b32-19+ |
| InChIKey | GEJPKONYCUHHAP-BIZUNTBRSA-N |
| XLogP | 4.78 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|