C34H29ClN4O6S — CID 99655394
N'-[(E)-[5-[[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-(4-phenoxyphenyl)oxamide (PubChem CID 99655394) has the molecular formula C34H29ClN4O6S and a molecular weight of 657.15 g/mol. Its IUPAC name is N'-[(E)-[5-[[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-(4-phenoxyphenyl)oxamide.
| Compound Name | N'-[(E)-[5-[[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-(4-phenoxyphenyl)oxamide |
|---|---|
| PubChem CID | 99655394 |
| Molecular Formula | C34H29ClN4O6S |
| Molecular Weight | 657.15 g/mol |
| Exact Mass | 656.15 |
| IUPAC Name | N'-[(E)-[5-[[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-(4-phenoxyphenyl)oxamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccc(Cl)cc2)Cc2ccc(/C=N/NC(=O)C(=O)Nc3ccc(Oc4ccccc4)cc3)o2)cc1 |
| InChI | InChI=1S/C34H29ClN4O6S/c1-24-7-19-32(20-8-24)46(42,43)39(22-25-9-11-26(35)12-10-25)23-31-18-17-30(45-31)21-36-38-34(41)33(40)37-27-13-15-29(16-14-27)44-28-5-3-2-4-6-28/h2-21H,22-23H2,1H3,(H,37,40)(H,38,41)/b36-21+ |
| InChIKey | QAZYYQZUHHROPH-QLQYKETESA-N |
| XLogP | 6.51 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.15 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|