C28H22Cl4N4O5S — CID 99655386
N-(3,5-dichlorophenyl)-N'-[(E)-[5-[[(3,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]oxamide (PubChem CID 99655386) has the molecular formula C28H22Cl4N4O5S and a molecular weight of 668.39 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-N'-[(E)-[5-[[(3,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]oxamide.
| Compound Name | N-(3,5-dichlorophenyl)-N'-[(E)-[5-[[(3,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 99655386 |
| Molecular Formula | C28H22Cl4N4O5S |
| Molecular Weight | 668.39 g/mol |
| Exact Mass | 666.01 |
| IUPAC Name | N-(3,5-dichlorophenyl)-N'-[(E)-[5-[[(3,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]oxamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccc(Cl)c(Cl)c2)Cc2ccc(/C=N/NC(=O)C(=O)Nc3cc(Cl)cc(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C28H22Cl4N4O5S/c1-17-2-7-24(8-3-17)42(39,40)36(15-18-4-9-25(31)26(32)10-18)16-23-6-5-22(41-23)14-33-35-28(38)27(37)34-21-12-19(29)11-20(30)13-21/h2-14H,15-16H2,1H3,(H,34,37)(H,35,38)/b33-14+ |
| InChIKey | JSJDHDHWVQHGAO-ZHSUKTGHSA-N |
| XLogP | 6.68 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.39 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|