C27H22BrClN4O5S — CID 99652804
N'-[(E)-[5-[[benzyl-(4-chlorophenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-(3-bromophenyl)oxamide (PubChem CID 99652804) has the molecular formula C27H22BrClN4O5S and a molecular weight of 629.92 g/mol. Its IUPAC name is N'-[(E)-[5-[[benzyl-(4-chlorophenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-(3-bromophenyl)oxamide.
| Compound Name | N'-[(E)-[5-[[benzyl-(4-chlorophenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-(3-bromophenyl)oxamide |
|---|---|
| PubChem CID | 99652804 |
| Molecular Formula | C27H22BrClN4O5S |
| Molecular Weight | 629.92 g/mol |
| Exact Mass | 628.02 |
| IUPAC Name | N'-[(E)-[5-[[benzyl-(4-chlorophenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-(3-bromophenyl)oxamide |
| SMILES | O=C(N/N=C/c1ccc(CN(Cc2ccccc2)S(=O)(=O)c2ccc(Cl)cc2)o1)C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C27H22BrClN4O5S/c28-20-7-4-8-22(15-20)31-26(34)27(35)32-30-16-23-11-12-24(38-23)18-33(17-19-5-2-1-3-6-19)39(36,37)25-13-9-21(29)10-14-25/h1-16H,17-18H2,(H,31,34)(H,32,35)/b30-16+ |
| InChIKey | CFDHAKZXBKXEAT-OKCVXOCRSA-N |
| XLogP | 5.18 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.92 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|