C29H27ClN4O7S — CID 98098018
N'-[(E)-[5-[[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]methyl]furan-2-yl]methylideneamino]-N-(2,4-dimethoxyphenyl)oxamide (PubChem CID 98098018) has the molecular formula C29H27ClN4O7S and a molecular weight of 611.08 g/mol. Its IUPAC name is N'-[(E)-[5-[[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]methyl]furan-2-yl]methylideneamino]-N-(2,4-dimethoxyphenyl)oxamide.
| Compound Name | N'-[(E)-[5-[[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]methyl]furan-2-yl]methylideneamino]-N-(2,4-dimethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 98098018 |
| Molecular Formula | C29H27ClN4O7S |
| Molecular Weight | 611.08 g/mol |
| Exact Mass | 610.13 |
| IUPAC Name | N'-[(E)-[5-[[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]methyl]furan-2-yl]methylideneamino]-N-(2,4-dimethoxyphenyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)N/N=C/c2ccc(CN(Cc3ccc(Cl)cc3)S(=O)(=O)c3ccccc3)o2)c(OC)c1 |
| InChI | InChI=1S/C29H27ClN4O7S/c1-39-22-14-15-26(27(16-22)40-2)32-28(35)29(36)33-31-17-23-12-13-24(41-23)19-34(18-20-8-10-21(30)11-9-20)42(37,38)25-6-4-3-5-7-25/h3-17H,18-19H2,1-2H3,(H,32,35)(H,33,36)/b31-17+ |
| InChIKey | TYTHZRNCXBRUFK-KBVAKVRCSA-N |
| XLogP | 4.43 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.08 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|