C29H26Cl2N4O5S — CID 98062613
N'-[(E)-[5-[[(3,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-(4-methylphenyl)oxamide (PubChem CID 98062613) has the molecular formula C29H26Cl2N4O5S and a molecular weight of 613.52 g/mol. Its IUPAC name is N'-[(E)-[5-[[(3,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-(4-methylphenyl)oxamide.
| Compound Name | N'-[(E)-[5-[[(3,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 98062613 |
| Molecular Formula | C29H26Cl2N4O5S |
| Molecular Weight | 613.52 g/mol |
| Exact Mass | 612.10 |
| IUPAC Name | N'-[(E)-[5-[[(3,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N/N=C/c2ccc(CN(Cc3ccc(Cl)c(Cl)c3)S(=O)(=O)c3ccc(C)cc3)o2)cc1 |
| InChI | InChI=1S/C29H26Cl2N4O5S/c1-19-3-8-22(9-4-19)33-28(36)29(37)34-32-16-23-10-11-24(40-23)18-35(17-21-7-14-26(30)27(31)15-21)41(38,39)25-12-5-20(2)6-13-25/h3-16H,17-18H2,1-2H3,(H,33,36)(H,34,37)/b32-16+ |
| InChIKey | YLYDOPQVGADYPJ-KPGMTVGESA-N |
| XLogP | 5.68 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|