C30H28Cl2N4O6S — CID 99683424
N'-[(E)-[5-[[(3,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-[(4-methoxyphenyl)methyl]oxamide (PubChem CID 99683424) has the molecular formula C30H28Cl2N4O6S and a molecular weight of 643.55 g/mol. Its IUPAC name is N'-[(E)-[5-[[(3,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-[(4-methoxyphenyl)methyl]oxamide.
| Compound Name | N'-[(E)-[5-[[(3,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-[(4-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 99683424 |
| Molecular Formula | C30H28Cl2N4O6S |
| Molecular Weight | 643.55 g/mol |
| Exact Mass | 642.11 |
| IUPAC Name | N'-[(E)-[5-[[(3,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-[(4-methoxyphenyl)methyl]oxamide |
| SMILES | COc1ccc(CNC(=O)C(=O)N/N=C/c2ccc(CN(Cc3ccc(Cl)c(Cl)c3)S(=O)(=O)c3ccc(C)cc3)o2)cc1 |
| InChI | InChI=1S/C30H28Cl2N4O6S/c1-20-3-12-26(13-4-20)43(39,40)36(18-22-7-14-27(31)28(32)15-22)19-25-11-10-24(42-25)17-34-35-30(38)29(37)33-16-21-5-8-23(41-2)9-6-21/h3-15,17H,16,18-19H2,1-2H3,(H,33,37)(H,35,38)/b34-17+ |
| InChIKey | USOHZKHHJKMDNC-KVAAJVFYSA-N |
| XLogP | 5.06 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|