C32H26Cl2N4O5S — CID 99655400
N'-[(E)-[5-[[(2,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-naphthalen-1-yloxamide (PubChem CID 99655400) has the molecular formula C32H26Cl2N4O5S and a molecular weight of 649.56 g/mol. Its IUPAC name is N'-[(E)-[5-[[(2,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-naphthalen-1-yloxamide.
| Compound Name | N'-[(E)-[5-[[(2,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-naphthalen-1-yloxamide |
|---|---|
| PubChem CID | 99655400 |
| Molecular Formula | C32H26Cl2N4O5S |
| Molecular Weight | 649.56 g/mol |
| Exact Mass | 648.10 |
| IUPAC Name | N'-[(E)-[5-[[(2,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-N-naphthalen-1-yloxamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccc(/C=N/NC(=O)C(=O)Nc3cccc4ccccc34)o2)Cc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C32H26Cl2N4O5S/c1-21-9-15-27(16-10-21)44(41,42)38(19-23-11-12-24(33)17-29(23)34)20-26-14-13-25(43-26)18-35-37-32(40)31(39)36-30-8-4-6-22-5-2-3-7-28(22)30/h2-18H,19-20H2,1H3,(H,36,39)(H,37,40)/b35-18+ |
| InChIKey | JQDGHIUWFYNFQE-MWBNBJEGSA-N |
| XLogP | 6.53 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.56 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|