C30H30N4O5S — CID 98062485
N-(2-methylphenyl)-N'-[(E)-[5-[[(4-methylphenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]oxamide (PubChem CID 98062485) has the molecular formula C30H30N4O5S and a molecular weight of 558.66 g/mol. Its IUPAC name is N-(2-methylphenyl)-N'-[(E)-[5-[[(4-methylphenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]oxamide.
| Compound Name | N-(2-methylphenyl)-N'-[(E)-[5-[[(4-methylphenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 98062485 |
| Molecular Formula | C30H30N4O5S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | N-(2-methylphenyl)-N'-[(E)-[5-[[(4-methylphenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]oxamide |
| SMILES | Cc1ccc(CN(Cc2ccc(/C=N/NC(=O)C(=O)Nc3ccccc3C)o2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H30N4O5S/c1-21-8-12-24(13-9-21)19-34(40(37,38)27-16-10-22(2)11-17-27)20-26-15-14-25(39-26)18-31-33-30(36)29(35)32-28-7-5-4-6-23(28)3/h4-18H,19-20H2,1-3H3,(H,32,35)(H,33,36)/b31-18+ |
| InChIKey | SDFBGWFCIZCHAL-FDAWAROLSA-N |
| XLogP | 4.68 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|