C28H32N4O5S — CID 98062472
N-[(E)-[5-[[(4-methylphenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-2-oxo-2-piperidin-1-ylacetamide (PubChem CID 98062472) has the molecular formula C28H32N4O5S and a molecular weight of 536.65 g/mol. Its IUPAC name is N-[(E)-[5-[[(4-methylphenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-2-oxo-2-piperidin-1-ylacetamide.
| Compound Name | N-[(E)-[5-[[(4-methylphenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-2-oxo-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 98062472 |
| Molecular Formula | C28H32N4O5S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | N-[(E)-[5-[[(4-methylphenyl)methyl-(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-2-oxo-2-piperidin-1-ylacetamide |
| SMILES | Cc1ccc(CN(Cc2ccc(/C=N/NC(=O)C(=O)N3CCCCC3)o2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H32N4O5S/c1-21-6-10-23(11-7-21)19-32(38(35,36)26-14-8-22(2)9-15-26)20-25-13-12-24(37-25)18-29-30-27(33)28(34)31-16-4-3-5-17-31/h6-15,18H,3-5,16-17,19-20H2,1-2H3,(H,30,33)/b29-18+ |
| InChIKey | FODYNOUSOIJROM-RDRPBHBLSA-N |
| XLogP | 3.75 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|