C24H23ClN4O5S — CID 94839800
N'-[(E)-[5-[[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]methyl]furan-2-yl]methylideneamino]-N-prop-2-enyloxamide (PubChem CID 94839800) has the molecular formula C24H23ClN4O5S and a molecular weight of 514.99 g/mol. Its IUPAC name is N'-[(E)-[5-[[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]methyl]furan-2-yl]methylideneamino]-N-prop-2-enyloxamide.
| Compound Name | N'-[(E)-[5-[[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]methyl]furan-2-yl]methylideneamino]-N-prop-2-enyloxamide |
|---|---|
| PubChem CID | 94839800 |
| Molecular Formula | C24H23ClN4O5S |
| Molecular Weight | 514.99 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | N'-[(E)-[5-[[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]methyl]furan-2-yl]methylideneamino]-N-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)N/N=C/c1ccc(CN(Cc2ccc(Cl)cc2)S(=O)(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C24H23ClN4O5S/c1-2-14-26-23(30)24(31)28-27-15-20-12-13-21(34-20)17-29(16-18-8-10-19(25)11-9-18)35(32,33)22-6-4-3-5-7-22/h2-13,15H,1,14,16-17H2,(H,26,30)(H,28,31)/b27-15+ |
| InChIKey | YYKZSAXAAZPPEW-JFLMPSFJSA-N |
| XLogP | 3.08 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.99 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|