C28H27BrN2O6S — CID 126015745
methyl (4E)-4-[[5-[[(4-bromophenyl)sulfonylamino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxo-1-(4-propan-2-ylphenyl)pyrrole-3-carboxylate (PubChem CID 126015745) has the molecular formula C28H27BrN2O6S and a molecular weight of 599.50 g/mol. Its IUPAC name is methyl (4E)-4-[[5-[[(4-bromophenyl)sulfonylamino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxo-1-(4-propan-2-ylphenyl)pyrrole-3-carboxylate.
| Compound Name | methyl (4E)-4-[[5-[[(4-bromophenyl)sulfonylamino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxo-1-(4-propan-2-ylphenyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126015745 |
| Molecular Formula | C28H27BrN2O6S |
| Molecular Weight | 599.50 g/mol |
| Exact Mass | 598.08 |
| IUPAC Name | methyl (4E)-4-[[5-[[(4-bromophenyl)sulfonylamino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxo-1-(4-propan-2-ylphenyl)pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccc(C(C)C)cc2)C(=O)/C1=C/c1ccc(CNS(=O)(=O)c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C28H27BrN2O6S/c1-17(2)19-5-9-21(10-6-19)31-18(3)26(28(33)36-4)25(27(31)32)15-22-11-12-23(37-22)16-30-38(34,35)24-13-7-20(29)8-14-24/h5-15,17,30H,16H2,1-4H3/b25-15+ |
| InChIKey | BSKDVOQVMOFBLC-MFKUBSTISA-N |
| XLogP | 5.52 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|