C27H21Cl2N3O6 — CID 126024104
methyl (4E)-4-[[5-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxo-1-phenylpyrrole-3-carboxylate (PubChem CID 126024104) has the molecular formula C27H21Cl2N3O6 and a molecular weight of 554.39 g/mol. Its IUPAC name is methyl (4E)-4-[[5-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxo-1-phenylpyrrole-3-carboxylate.
| Compound Name | methyl (4E)-4-[[5-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxo-1-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126024104 |
| Molecular Formula | C27H21Cl2N3O6 |
| Molecular Weight | 554.39 g/mol |
| Exact Mass | 553.08 |
| IUPAC Name | methyl (4E)-4-[[5-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxo-1-phenylpyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccccc2)C(=O)/C1=C/c1ccc(CNC(=O)C(=O)Nc2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C27H21Cl2N3O6/c1-15-23(27(36)37-2)20(26(35)32(15)17-6-4-3-5-7-17)13-18-9-10-19(38-18)14-30-24(33)25(34)31-16-8-11-21(28)22(29)12-16/h3-13H,14H2,1-2H3,(H,30,33)(H,31,34)/b20-13+ |
| InChIKey | XBWXVHGBAPZREI-DEDYPNTBSA-N |
| XLogP | 4.72 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|