C27H22FN3O6 — CID 126191158
methyl (5E)-5-[[5-[[[2-(4-fluoroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-2-methyl-4-oxo-1-phenylpyrrole-3-carboxylate (PubChem CID 126191158) has the molecular formula C27H22FN3O6 and a molecular weight of 503.49 g/mol. Its IUPAC name is methyl (5E)-5-[[5-[[[2-(4-fluoroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-2-methyl-4-oxo-1-phenylpyrrole-3-carboxylate.
| Compound Name | methyl (5E)-5-[[5-[[[2-(4-fluoroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-2-methyl-4-oxo-1-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126191158 |
| Molecular Formula | C27H22FN3O6 |
| Molecular Weight | 503.49 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | methyl (5E)-5-[[5-[[[2-(4-fluoroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-2-methyl-4-oxo-1-phenylpyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccccc2)/C(=C/c2ccc(CNC(=O)C(=O)Nc3ccc(F)cc3)o2)C1=O |
| InChI | InChI=1S/C27H22FN3O6/c1-16-23(27(35)36-2)24(32)22(31(16)19-6-4-3-5-7-19)14-20-12-13-21(37-20)15-29-25(33)26(34)30-18-10-8-17(28)9-11-18/h3-14H,15H2,1-2H3,(H,29,33)(H,30,34)/b22-14+ |
| InChIKey | ILSDUXYDLRHQES-HYARGMPZSA-N |
| XLogP | 3.55 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|