C23H23N3O6 — CID 126021133
methyl (4E)-1,2-dimethyl-4-[[5-[[[2-(4-methylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-5-oxopyrrole-3-carboxylate (PubChem CID 126021133) has the molecular formula C23H23N3O6 and a molecular weight of 437.45 g/mol. Its IUPAC name is methyl (4E)-1,2-dimethyl-4-[[5-[[[2-(4-methylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4E)-1,2-dimethyl-4-[[5-[[[2-(4-methylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126021133 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | methyl (4E)-1,2-dimethyl-4-[[5-[[[2-(4-methylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-5-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(C)C(=O)/C1=C/c1ccc(CNC(=O)C(=O)Nc2ccc(C)cc2)o1 |
| InChI | InChI=1S/C23H23N3O6/c1-13-5-7-15(8-6-13)25-21(28)20(27)24-12-17-10-9-16(32-17)11-18-19(23(30)31-4)14(2)26(3)22(18)29/h5-11H,12H2,1-4H3,(H,24,27)(H,25,28)/b18-11+ |
| InChIKey | QBKKTSQCBOQWDM-WOJGMQOQSA-N |
| XLogP | 2.15 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|