C31H29N3O9 — CID 126017806
methyl (4E)-4-[[5-[[[2-(4-ethoxycarbonylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-(3-methoxyphenyl)-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 126017806) has the molecular formula C31H29N3O9 and a molecular weight of 587.59 g/mol. Its IUPAC name is methyl (4E)-4-[[5-[[[2-(4-ethoxycarbonylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-(3-methoxyphenyl)-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4E)-4-[[5-[[[2-(4-ethoxycarbonylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-(3-methoxyphenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126017806 |
| Molecular Formula | C31H29N3O9 |
| Molecular Weight | 587.59 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | methyl (4E)-4-[[5-[[[2-(4-ethoxycarbonylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-(3-methoxyphenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(=O)NCc2ccc(/C=C3/C(=O)N(c4cccc(OC)c4)C(C)=C3C(=O)OC)o2)cc1 |
| InChI | InChI=1S/C31H29N3O9/c1-5-42-30(38)19-9-11-20(12-10-19)33-28(36)27(35)32-17-24-14-13-23(43-24)16-25-26(31(39)41-4)18(2)34(29(25)37)21-7-6-8-22(15-21)40-3/h6-16H,5,17H2,1-4H3,(H,32,35)(H,33,36)/b25-16+ |
| InChIKey | MVZCNWPIIRMZLT-PCLIKHOPSA-N |
| XLogP | 3.60 |
| TPSA | 153.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|