C28H24ClN3O6 — CID 126010334
ethyl (4E)-4-[[5-[[[2-(3-chloroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxo-1-phenylpyrrole-3-carboxylate (PubChem CID 126010334) has the molecular formula C28H24ClN3O6 and a molecular weight of 533.97 g/mol. Its IUPAC name is ethyl (4E)-4-[[5-[[[2-(3-chloroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxo-1-phenylpyrrole-3-carboxylate.
| Compound Name | ethyl (4E)-4-[[5-[[[2-(3-chloroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxo-1-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126010334 |
| Molecular Formula | C28H24ClN3O6 |
| Molecular Weight | 533.97 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | ethyl (4E)-4-[[5-[[[2-(3-chloroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxo-1-phenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2ccccc2)C(=O)/C1=C/c1ccc(CNC(=O)C(=O)Nc2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C28H24ClN3O6/c1-3-37-28(36)24-17(2)32(20-10-5-4-6-11-20)27(35)23(24)15-21-12-13-22(38-21)16-30-25(33)26(34)31-19-9-7-8-18(29)14-19/h4-15H,3,16H2,1-2H3,(H,30,33)(H,31,34)/b23-15+ |
| InChIKey | KJMJHICLNLMPQY-HZHRSRAPSA-N |
| XLogP | 4.46 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.97 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|