C25H27N3O7 — CID 126027505
methyl (4E)-4-[[5-[[(2-anilino-2-oxoacetyl)amino]methyl]furan-2-yl]methylidene]-1-(3-methoxypropyl)-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 126027505) has the molecular formula C25H27N3O7 and a molecular weight of 481.51 g/mol. Its IUPAC name is methyl (4E)-4-[[5-[[(2-anilino-2-oxoacetyl)amino]methyl]furan-2-yl]methylidene]-1-(3-methoxypropyl)-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4E)-4-[[5-[[(2-anilino-2-oxoacetyl)amino]methyl]furan-2-yl]methylidene]-1-(3-methoxypropyl)-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126027505 |
| Molecular Formula | C25H27N3O7 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | methyl (4E)-4-[[5-[[(2-anilino-2-oxoacetyl)amino]methyl]furan-2-yl]methylidene]-1-(3-methoxypropyl)-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | COCCCN1C(=O)/C(=C/c2ccc(CNC(=O)C(=O)Nc3ccccc3)o2)C(C(=O)OC)=C1C |
| InChI | InChI=1S/C25H27N3O7/c1-16-21(25(32)34-3)20(24(31)28(16)12-7-13-33-2)14-18-10-11-19(35-18)15-26-22(29)23(30)27-17-8-5-4-6-9-17/h4-6,8-11,14H,7,12-13,15H2,1-3H3,(H,26,29)(H,27,30)/b20-14+ |
| InChIKey | VVDIUSKMRMHEMX-XSFVSMFZSA-N |
| XLogP | 2.24 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|