C27H31N3O6 — CID 126009415
ethyl (4E)-2-methyl-4-[[5-[[[2-(4-methylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-(2-methylpropyl)-5-oxopyrrole-3-carboxylate (PubChem CID 126009415) has the molecular formula C27H31N3O6 and a molecular weight of 493.56 g/mol. Its IUPAC name is ethyl (4E)-2-methyl-4-[[5-[[[2-(4-methylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-(2-methylpropyl)-5-oxopyrrole-3-carboxylate.
| Compound Name | ethyl (4E)-2-methyl-4-[[5-[[[2-(4-methylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-(2-methylpropyl)-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126009415 |
| Molecular Formula | C27H31N3O6 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | ethyl (4E)-2-methyl-4-[[5-[[[2-(4-methylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-(2-methylpropyl)-5-oxopyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(CC(C)C)C(=O)/C1=C/c1ccc(CNC(=O)C(=O)Nc2ccc(C)cc2)o1 |
| InChI | InChI=1S/C27H31N3O6/c1-6-35-27(34)23-18(5)30(15-16(2)3)26(33)22(23)13-20-11-12-21(36-20)14-28-24(31)25(32)29-19-9-7-17(4)8-10-19/h7-13,16H,6,14-15H2,1-5H3,(H,28,31)(H,29,32)/b22-13+ |
| InChIKey | AXHNULMRVYFWCI-LPYMAVHISA-N |
| XLogP | 3.56 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|