C32H31N3O9 — CID 126020741
methyl (4E)-4-[[5-[[[2-(4-ethoxycarbonylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-[(4-methoxyphenyl)methyl]-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 126020741) has the molecular formula C32H31N3O9 and a molecular weight of 601.61 g/mol. Its IUPAC name is methyl (4E)-4-[[5-[[[2-(4-ethoxycarbonylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-[(4-methoxyphenyl)methyl]-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4E)-4-[[5-[[[2-(4-ethoxycarbonylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-[(4-methoxyphenyl)methyl]-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126020741 |
| Molecular Formula | C32H31N3O9 |
| Molecular Weight | 601.61 g/mol |
| Exact Mass | 601.21 |
| IUPAC Name | methyl (4E)-4-[[5-[[[2-(4-ethoxycarbonylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-[(4-methoxyphenyl)methyl]-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(=O)NCc2ccc(/C=C3/C(=O)N(Cc4ccc(OC)cc4)C(C)=C3C(=O)OC)o2)cc1 |
| InChI | InChI=1S/C32H31N3O9/c1-5-43-31(39)21-8-10-22(11-9-21)34-29(37)28(36)33-17-25-15-14-24(44-25)16-26-27(32(40)42-4)19(2)35(30(26)38)18-20-6-12-23(41-3)13-7-20/h6-16H,5,17-18H2,1-4H3,(H,33,36)(H,34,37)/b26-16+ |
| InChIKey | PCRVNVSHOHCMEI-WGOQTCKBSA-N |
| XLogP | 3.59 |
| TPSA | 153.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|