C28H24ClN3O7 — CID 126021535
methyl (4E)-4-[[5-[[[2-(3-chloroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-(3-methoxyphenyl)-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 126021535) has the molecular formula C28H24ClN3O7 and a molecular weight of 549.97 g/mol. Its IUPAC name is methyl (4E)-4-[[5-[[[2-(3-chloroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-(3-methoxyphenyl)-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4E)-4-[[5-[[[2-(3-chloroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-(3-methoxyphenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126021535 |
| Molecular Formula | C28H24ClN3O7 |
| Molecular Weight | 549.97 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | methyl (4E)-4-[[5-[[[2-(3-chloroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-(3-methoxyphenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2cccc(OC)c2)C(=O)/C1=C/c1ccc(CNC(=O)C(=O)Nc2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C28H24ClN3O7/c1-16-24(28(36)38-3)23(27(35)32(16)19-8-5-9-20(13-19)37-2)14-21-10-11-22(39-21)15-30-25(33)26(34)31-18-7-4-6-17(29)12-18/h4-14H,15H2,1-3H3,(H,30,33)(H,31,34)/b23-14+ |
| InChIKey | QXOOQPPZBKCLPG-OEAKJJBVSA-N |
| XLogP | 4.07 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.97 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|