C30H29N3O6 — CID 126012401
methyl (4E)-2-methyl-4-[[5-[[[2-(4-methylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-[(4-methylphenyl)methyl]-5-oxopyrrole-3-carboxylate (PubChem CID 126012401) has the molecular formula C30H29N3O6 and a molecular weight of 527.58 g/mol. Its IUPAC name is methyl (4E)-2-methyl-4-[[5-[[[2-(4-methylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-[(4-methylphenyl)methyl]-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4E)-2-methyl-4-[[5-[[[2-(4-methylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-[(4-methylphenyl)methyl]-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126012401 |
| Molecular Formula | C30H29N3O6 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | methyl (4E)-2-methyl-4-[[5-[[[2-(4-methylanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-1-[(4-methylphenyl)methyl]-5-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(Cc2ccc(C)cc2)C(=O)/C1=C/c1ccc(CNC(=O)C(=O)Nc2ccc(C)cc2)o1 |
| InChI | InChI=1S/C30H29N3O6/c1-18-5-9-21(10-6-18)17-33-20(3)26(30(37)38-4)25(29(33)36)15-23-13-14-24(39-23)16-31-27(34)28(35)32-22-11-7-19(2)8-12-22/h5-15H,16-17H2,1-4H3,(H,31,34)(H,32,35)/b25-15+ |
| InChIKey | WCDCULNYWAJENS-MFKUBSTISA-N |
| XLogP | 4.02 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|