C28H22Cl3N3O6 — CID 126020429
methyl (4E)-1-(3-chloro-4-methylphenyl)-4-[[5-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 126020429) has the molecular formula C28H22Cl3N3O6 and a molecular weight of 602.86 g/mol. Its IUPAC name is methyl (4E)-1-(3-chloro-4-methylphenyl)-4-[[5-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4E)-1-(3-chloro-4-methylphenyl)-4-[[5-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126020429 |
| Molecular Formula | C28H22Cl3N3O6 |
| Molecular Weight | 602.86 g/mol |
| Exact Mass | 601.06 |
| IUPAC Name | methyl (4E)-1-(3-chloro-4-methylphenyl)-4-[[5-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]amino]methyl]furan-2-yl]methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccc(C)c(Cl)c2)C(=O)/C1=C/c1ccc(CNC(=O)C(=O)Nc2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C28H22Cl3N3O6/c1-14-4-6-17(11-22(14)30)34-15(2)24(28(38)39-3)20(27(34)37)12-18-7-8-19(40-18)13-32-25(35)26(36)33-16-5-9-21(29)23(31)10-16/h4-12H,13H2,1-3H3,(H,32,35)(H,33,36)/b20-12+ |
| InChIKey | WGEDANJWNJXTNW-UDWIEESQSA-N |
| XLogP | 5.68 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.86 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|