C16H12BrN3O6S — CID 126190516
4-bromo-N-[[5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]methyl]benzenesulfonamide (PubChem CID 126190516) has the molecular formula C16H12BrN3O6S and a molecular weight of 454.26 g/mol. Its IUPAC name is 4-bromo-N-[[5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]methyl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[[5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 126190516 |
| Molecular Formula | C16H12BrN3O6S |
| Molecular Weight | 454.26 g/mol |
| Exact Mass | 452.96 |
| IUPAC Name | 4-bromo-N-[[5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]methyl]benzenesulfonamide |
| SMILES | O=C1NC(=O)C(=Cc2ccc(CNS(=O)(=O)c3ccc(Br)cc3)o2)C(=O)N1 |
| InChI | InChI=1S/C16H12BrN3O6S/c17-9-1-5-12(6-2-9)27(24,25)18-8-11-4-3-10(26-11)7-13-14(21)19-16(23)20-15(13)22/h1-7,18H,8H2,(H2,19,20,21,22,23) |
| InChIKey | VRBJACQJJRWHMM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|