C13H13BrN4O4S — CID 99972908
[(Z)-[5-[[(4-bromophenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]urea (PubChem CID 99972908) has the molecular formula C13H13BrN4O4S and a molecular weight of 401.24 g/mol. Its IUPAC name is [(Z)-[5-[[(4-bromophenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]urea.
| Compound Name | [(Z)-[5-[[(4-bromophenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 99972908 |
| Molecular Formula | C13H13BrN4O4S |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 399.98 |
| IUPAC Name | [(Z)-[5-[[(4-bromophenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]urea |
| SMILES | NC(=O)N/N=C\c1ccc(CNS(=O)(=O)c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C13H13BrN4O4S/c14-9-1-5-12(6-2-9)23(20,21)17-8-11-4-3-10(22-11)7-16-18-13(15)19/h1-7,17H,8H2,(H3,15,18,19)/b16-7- |
| InChIKey | XVOAAUGFVHRZNC-APSNUPSMSA-N |
| XLogP | 1.52 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|