C19H17BrN4O3S2 — CID 133225267
1-[(E)-[5-[[(4-bromophenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-3-phenylthiourea (PubChem CID 133225267) has the molecular formula C19H17BrN4O3S2 and a molecular weight of 493.41 g/mol. Its IUPAC name is 1-[(E)-[5-[[(4-bromophenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(E)-[5-[[(4-bromophenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 133225267 |
| Molecular Formula | C19H17BrN4O3S2 |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 491.99 |
| IUPAC Name | 1-[(E)-[5-[[(4-bromophenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-3-phenylthiourea |
| SMILES | O=S(=O)(NCc1ccc(/C=N/NC(=S)Nc2ccccc2)o1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H17BrN4O3S2/c20-14-6-10-18(11-7-14)29(25,26)22-13-17-9-8-16(27-17)12-21-24-19(28)23-15-4-2-1-3-5-15/h1-12,22H,13H2,(H2,23,24,28)/b21-12+ |
| InChIKey | CDOXONZLKQQURG-CIAFOILYSA-N |
| XLogP | 3.84 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|