C19H17ClN4O4S — CID 133225256
1-[(E)-[5-[[(4-chlorophenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-3-phenylurea (PubChem CID 133225256) has the molecular formula C19H17ClN4O4S and a molecular weight of 432.89 g/mol. Its IUPAC name is 1-[(E)-[5-[[(4-chlorophenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-3-phenylurea.
| Compound Name | 1-[(E)-[5-[[(4-chlorophenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-3-phenylurea |
|---|---|
| PubChem CID | 133225256 |
| Molecular Formula | C19H17ClN4O4S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 1-[(E)-[5-[[(4-chlorophenyl)sulfonylamino]methyl]furan-2-yl]methylideneamino]-3-phenylurea |
| SMILES | O=C(N/N=C/c1ccc(CNS(=O)(=O)c2ccc(Cl)cc2)o1)Nc1ccccc1 |
| InChI | InChI=1S/C19H17ClN4O4S/c20-14-6-10-18(11-7-14)29(26,27)22-13-17-9-8-16(28-17)12-21-24-19(25)23-15-4-2-1-3-5-15/h1-12,22H,13H2,(H2,23,24,25)/b21-12+ |
| InChIKey | IULYEXAOSBLSSQ-CIAFOILYSA-N |
| XLogP | 3.57 |
| TPSA | 112.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|