C14H13F2N3O2S — CID 9242399
1-[(Z)-[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylideneamino]-3-phenylurea (PubChem CID 9242399) has the molecular formula C14H13F2N3O2S and a molecular weight of 325.34 g/mol. Its IUPAC name is 1-[(Z)-[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylideneamino]-3-phenylurea.
| Compound Name | 1-[(Z)-[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylideneamino]-3-phenylurea |
|---|---|
| PubChem CID | 9242399 |
| Molecular Formula | C14H13F2N3O2S |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 1-[(Z)-[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylideneamino]-3-phenylurea |
| SMILES | O=C(N/N=C\c1ccc(CSC(F)F)o1)Nc1ccccc1 |
| InChI | InChI=1S/C14H13F2N3O2S/c15-13(16)22-9-12-7-6-11(21-12)8-17-19-14(20)18-10-4-2-1-3-5-10/h1-8,13H,9H2,(H2,18,19,20)/b17-8- |
| InChIKey | ZQYGLDICNYTNRU-IUXPMGMMSA-N |
| XLogP | 3.89 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|