C14H11BrF2N2O2S — CID 9016448
2-bromo-N-[(Z)-[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylideneamino]benzamide (PubChem CID 9016448) has the molecular formula C14H11BrF2N2O2S and a molecular weight of 389.22 g/mol. Its IUPAC name is 2-bromo-N-[(Z)-[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(Z)-[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 9016448 |
| Molecular Formula | C14H11BrF2N2O2S |
| Molecular Weight | 389.22 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | 2-bromo-N-[(Z)-[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(CSC(F)F)o1)c1ccccc1Br |
| InChI | InChI=1S/C14H11BrF2N2O2S/c15-12-4-2-1-3-11(12)13(20)19-18-7-9-5-6-10(21-9)8-22-14(16)17/h1-7,14H,8H2,(H,19,20)/b18-7- |
| InChIKey | PMFZKSAKMHGPOF-WSVATBPTSA-N |
| XLogP | 4.26 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.22 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|