C12H9Br2N3OS — CID 1282032
1-[(4,5-dibromofuran-2-yl)methylideneamino]-3-phenylthiourea (PubChem CID 1282032) has the molecular formula C12H9Br2N3OS and a molecular weight of 403.10 g/mol. Its IUPAC name is 1-[(4,5-dibromofuran-2-yl)methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(4,5-dibromofuran-2-yl)methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 1282032 |
| Molecular Formula | C12H9Br2N3OS |
| Molecular Weight | 403.10 g/mol |
| Exact Mass | 400.88 |
| IUPAC Name | 1-[(4,5-dibromofuran-2-yl)methylideneamino]-3-phenylthiourea |
| SMILES | S=C(NN=Cc1cc(Br)c(Br)o1)Nc1ccccc1 |
| InChI | InChI=1S/C12H9Br2N3OS/c13-10-6-9(18-11(10)14)7-15-17-12(19)16-8-4-2-1-3-5-8/h1-7H,(H2,16,17,19) |
| InChIKey | LYVUGRRGIZDNHP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.10 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|