C11H10BrN5S — CID 2727280
1-[(4-bromo-1H-pyrazol-5-yl)methylideneamino]-3-phenylthiourea (PubChem CID 2727280) has the molecular formula C11H10BrN5S and a molecular weight of 324.21 g/mol. Its IUPAC name is 1-[(4-bromo-1H-pyrazol-5-yl)methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(4-bromo-1H-pyrazol-5-yl)methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 2727280 |
| Molecular Formula | C11H10BrN5S |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 1-[(4-bromo-1H-pyrazol-5-yl)methylideneamino]-3-phenylthiourea |
| SMILES | S=C(NN=Cc1[nH]ncc1Br)Nc1ccccc1 |
| InChI | InChI=1S/C11H10BrN5S/c12-9-6-13-16-10(9)7-14-17-11(18)15-8-4-2-1-3-5-8/h1-7H,(H,13,16)(H2,15,17,18) |
| InChIKey | RZDOAEYLBBUURZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|