C14H15N5S — CID 136843636
1-[(Z)-(4-phenyl-1H-pyrazol-5-yl)methylideneamino]-3-prop-2-enylthiourea (PubChem CID 136843636) has the molecular formula C14H15N5S and a molecular weight of 285.38 g/mol. Its IUPAC name is 1-[(Z)-(4-phenyl-1H-pyrazol-5-yl)methylideneamino]-3-prop-2-enylthiourea.
| Compound Name | 1-[(Z)-(4-phenyl-1H-pyrazol-5-yl)methylideneamino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 136843636 |
| Molecular Formula | C14H15N5S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-[(Z)-(4-phenyl-1H-pyrazol-5-yl)methylideneamino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)N/N=C\c1[nH]ncc1-c1ccccc1 |
| InChI | InChI=1S/C14H15N5S/c1-2-8-15-14(20)19-17-10-13-12(9-16-18-13)11-6-4-3-5-7-11/h2-7,9-10H,1,8H2,(H,16,18)(H2,15,19,20)/b17-10- |
| InChIKey | HQYANKPIWGWSEY-YVLHZVERSA-N |
| XLogP | 2.06 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|